C19H22IN3O — CID 3768941
4-(2,4-dimethylphenyl)-N-(3-iodophenyl)piperazine-1-carboxamide (PubChem CID 3768941) has the molecular formula C19H22IN3O and a molecular weight of 435.31 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-N-(3-iodophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethylphenyl)-N-(3-iodophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3768941 |
| Molecular Formula | C19H22IN3O |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-N-(3-iodophenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)Nc3cccc(I)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22IN3O/c1-14-6-7-18(15(2)12-14)22-8-10-23(11-9-22)19(24)21-17-5-3-4-16(20)13-17/h3-7,12-13H,8-11H2,1-2H3,(H,21,24) |
| InChIKey | PRRJDQHLEMTGPQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|