About 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole
4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole (PubChem CID 3769567) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole.
Molecular Properties
| Compound Name | 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| PubChem CID | 3769567 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| SMILES | CC12CCOC1N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C18H19NO/c1-18-11-12-20-17(18)19(13-14-7-3-2-4-8-14)16-10-6-5-9-15(16)18/h2-10,17H,11-13H2,1H3 |
| InChIKey | NCMVPGABXJTSGZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The IUPAC name of 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole (CID 3769567) is 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole.
What is the SMILES notation for 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The canonical SMILES for 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole is CC12CCOC1N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The InChIKey is NCMVPGABXJTSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-18-11-12-20-17(18)19(13-14-7-3-2-4-8-14)16-10-6-5-9-15(16)18/h2-10,17H,11-13H2,1H3.
What are the key properties of 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole has a molecular weight of 265.36 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-8b-methyl-2,3a-dihydro-1H-furo[2,3-b]indole is sourced from PubChem (CID 3769567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).