C16H13Cl2N5O — CID 3769643
N-[(2,4-dichlorophenyl)methoxy]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanimine (PubChem CID 3769643) has the molecular formula C16H13Cl2N5O and a molecular weight of 362.22 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methoxy]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanimine.
| Compound Name | N-[(2,4-dichlorophenyl)methoxy]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 3769643 |
| Molecular Formula | C16H13Cl2N5O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methoxy]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanimine |
| SMILES | Clc1ccc(CON=CCc2nc(-c3cccnc3)n[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N5O/c17-13-4-3-12(14(18)8-13)10-24-20-7-5-15-21-16(23-22-15)11-2-1-6-19-9-11/h1-4,6-9H,5,10H2,(H,21,22,23) |
| InChIKey | OYBNNMDMQQJUAW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|