C23H19NO3 — CID 3770215
5-(3,4-dihydroxyphenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one (PubChem CID 3770215) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(3,4-dihydroxyphenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one.
| Compound Name | 5-(3,4-dihydroxyphenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 3770215 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-(3,4-dihydroxyphenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
| SMILES | O=C1CCCC2=C1C(c1ccc(O)c(O)c1)Nc1ccc3ccccc3c12 |
| InChI | InChI=1S/C23H19NO3/c25-18-11-9-14(12-20(18)27)23-22-16(6-3-7-19(22)26)21-15-5-2-1-4-13(15)8-10-17(21)24-23/h1-2,4-5,8-12,23-25,27H,3,6-7H2 |
| InChIKey | YKQAJGSSHLQDEZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|