About 1-cyclohexyladamantane
1-cyclohexyladamantane (PubChem CID 3770255) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-cyclohexyladamantane.
Molecular Properties
| Compound Name | 1-cyclohexyladamantane |
| PubChem CID | 3770255 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-cyclohexyladamantane |
| SMILES | C1CCC(C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C16H26/c1-2-4-15(5-3-1)16-9-12-6-13(10-16)8-14(7-12)11-16/h12-15H,1-11H2 |
| InChIKey | CQGHTYOKYHAPCM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyladamantane?
The IUPAC name of 1-cyclohexyladamantane (CID 3770255) is 1-cyclohexyladamantane.
What is the SMILES notation for 1-cyclohexyladamantane?
The canonical SMILES for 1-cyclohexyladamantane is C1CCC(C23CC4CC(CC(C4)C2)C3)CC1.
What is the InChIKey of 1-cyclohexyladamantane?
The InChIKey is CQGHTYOKYHAPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26/c1-2-4-15(5-3-1)16-9-12-6-13(10-16)8-14(7-12)11-16/h12-15H,1-11H2.
What are the key properties of 1-cyclohexyladamantane?
1-cyclohexyladamantane has a molecular weight of 218.38 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyladamantane is sourced from PubChem (CID 3770255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).