C31H33N3O — CID 3770419
2-[(7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-ylidene)amino]-2-methylpropan-1-ol (PubChem CID 3770419) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[(7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-ylidene)amino]-2-methylpropan-1-ol.
| Compound Name | 2-[(7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-ylidene)amino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 3770419 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-[(7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-ylidene)amino]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)/N=C1\C=CC2=NC34CCCCC3C(c3ccccc3)C=C(c3ccccc3)N4C2=C1 |
| InChI | InChI=1S/C31H33N3O/c1-30(2,21-35)32-24-16-17-27-29(19-24)34-28(23-13-7-4-8-14-23)20-25(22-11-5-3-6-12-22)26-15-9-10-18-31(26,34)33-27/h3-8,11-14,16-17,19-20,25-26,35H,9-10,15,18,21H2,1-2H3/b32-24+ |
| InChIKey | JKGGCHDSQXCXHZ-FEZSWGLMSA-N |
| XLogP | 6.13 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|