About dicyclohexylazanium
dicyclohexylazanium (PubChem CID 3770554) has the molecular formula C12H24N+
and a molecular weight of 182.33 g/mol. Its IUPAC name is dicyclohexylazanium.
Molecular Properties
| Compound Name | dicyclohexylazanium |
| PubChem CID | 3770554 |
| Molecular Formula | C12H24N+ |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.19 |
| IUPAC Name | dicyclohexylazanium |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H23N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2/p+1 |
| InChIKey | XBPCUCUWBYBCDP-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dicyclohexylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylazanium?
The IUPAC name of dicyclohexylazanium (CID 3770554) is dicyclohexylazanium.
What is the SMILES notation for dicyclohexylazanium?
The canonical SMILES for dicyclohexylazanium is C1CCC([NH2+]C2CCCCC2)CC1.
What is the InChIKey of dicyclohexylazanium?
The InChIKey is XBPCUCUWBYBCDP-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H23N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2/p+1.
What are the key properties of dicyclohexylazanium?
dicyclohexylazanium has a molecular weight of 182.33 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylazanium is sourced from PubChem (CID 3770554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).