About 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine
3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 3770603) has the molecular formula C5H2BrClN4
and a molecular weight of 233.46 g/mol. Its IUPAC name is 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine.
Molecular Properties
| Compound Name | 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| PubChem CID | 3770603 |
| Molecular Formula | C5H2BrClN4 |
| Molecular Weight | 233.46 g/mol |
| Exact Mass | 231.92 |
| IUPAC Name | 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Clc1ccc2nnc(Br)n2n1 |
| InChI | InChI=1S/C5H2BrClN4/c6-5-9-8-4-2-1-3(7)10-11(4)5/h1-2H |
| InChIKey | CGCZYGSVCBHXEC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (CID 3770603) is 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine is Clc1ccc2nnc(Br)n2n1.
What is the InChIKey of 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is CGCZYGSVCBHXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrClN4/c6-5-9-8-4-2-1-3(7)10-11(4)5/h1-2H.
What are the key properties of 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine?
3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 233.46 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 3770603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).