C23H25F3N2O2S — CID 3770984
3,5a,10-trimethyl-8-[4-(trifluoromethyl)anilino]-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one (PubChem CID 3770984) has the molecular formula C23H25F3N2O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is 3,5a,10-trimethyl-8-[4-(trifluoromethyl)anilino]-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one.
| Compound Name | 3,5a,10-trimethyl-8-[4-(trifluoromethyl)anilino]-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 3770984 |
| Molecular Formula | C23H25F3N2O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3,5a,10-trimethyl-8-[4-(trifluoromethyl)anilino]-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one |
| SMILES | CC1C(=O)OC2C1CCC1(C)Cc3sc(Nc4ccc(C(F)(F)F)cc4)nc3C(C)C21 |
| InChI | InChI=1S/C23H25F3N2O2S/c1-11-15-8-9-22(3)10-16-18(12(2)17(22)19(15)30-20(11)29)28-21(31-16)27-14-6-4-13(5-7-14)23(24,25)26/h4-7,11-12,15,17,19H,8-10H2,1-3H3,(H,27,28) |
| InChIKey | ZSOOWWZZMDBQRX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |