C33H37N3O4 — CID 3771103
3-tert-butyl-7-[3-(2,6-dimethylmorpholin-4-yl)propylamino]-14H-naphtho[3,2-a]phenoxazine-8,13-dione (PubChem CID 3771103) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is 3-tert-butyl-7-[3-(2,6-dimethylmorpholin-4-yl)propylamino]-14H-naphtho[3,2-a]phenoxazine-8,13-dione.
| Compound Name | 3-tert-butyl-7-[3-(2,6-dimethylmorpholin-4-yl)propylamino]-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
|---|---|
| PubChem CID | 3771103 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 3-tert-butyl-7-[3-(2,6-dimethylmorpholin-4-yl)propylamino]-14H-naphtho[3,2-a]phenoxazine-8,13-dione |
| SMILES | CC1CN(CCCNc2cc3oc4cc(C(C)(C)C)ccc4[nH]c3c3c(=O)c4ccccc4c(=O)c23)CC(C)O1 |
| InChI | InChI=1S/C33H37N3O4/c1-19-17-36(18-20(2)39-19)14-8-13-34-25-16-27-30(35-24-12-11-21(33(3,4)5)15-26(24)40-27)29-28(25)31(37)22-9-6-7-10-23(22)32(29)38/h6-7,9-12,15-16,19-20,34-35H,8,13-14,17-18H2,1-5H3 |
| InChIKey | ZPTUJUIJPSRSCZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|