About 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane
2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane (PubChem CID 3771225) has the molecular formula C16H23FO2
and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane.
Molecular Properties
| Compound Name | 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane |
| PubChem CID | 3771225 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane |
| SMILES | CCC1(COCc2ccccc2F)CCC(C)(C)O1 |
| InChI | InChI=1S/C16H23FO2/c1-4-16(10-9-15(2,3)19-16)12-18-11-13-7-5-6-8-14(13)17/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | WUHXBAXZWLXJPI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane?
The IUPAC name of 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane (CID 3771225) is 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane.
What is the SMILES notation for 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane?
The canonical SMILES for 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane is CCC1(COCc2ccccc2F)CCC(C)(C)O1.
What is the InChIKey of 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane?
The InChIKey is WUHXBAXZWLXJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FO2/c1-4-16(10-9-15(2,3)19-16)12-18-11-13-7-5-6-8-14(13)17/h5-8H,4,9-12H2,1-3H3.
What are the key properties of 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane?
2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane has a molecular weight of 266.36 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[(2-fluorophenyl)methoxymethyl]-5,5-dimethyloxolane is sourced from PubChem (CID 3771225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).