C25H27N3O — CID 3771400
5-(4-benzhydrylpiperazin-1-yl)-1,5,6,7-tetrahydroindol-4-one (PubChem CID 3771400) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 5-(4-benzhydrylpiperazin-1-yl)-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 5-(4-benzhydrylpiperazin-1-yl)-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 3771400 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 5-(4-benzhydrylpiperazin-1-yl)-1,5,6,7-tetrahydroindol-4-one |
| SMILES | O=C1c2cc[nH]c2CCC1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O/c29-25-21-13-14-26-22(21)11-12-23(25)27-15-17-28(18-16-27)24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,13-14,23-24,26H,11-12,15-18H2 |
| InChIKey | DSZFPFDPEPAIMR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |