About Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate
Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate (PubChem CID 3771443) has the molecular formula C19H21N5O3
and a molecular weight of 367.40 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate |
| PubChem CID | 3771443 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN=C(N=C1NC2=CC=C(C=C2)OC)N3C(=CC(=N3)C)C |
| InChI | InChI=1S/C19H21N5O3/c1-5-27-18(25)16-11-20-19(24-13(3)10-12(2)23-24)22-17(16)21-14-6-8-15(26-4)9-7-14/h6-11H,5H2,1-4H3,(H,20,21,22) |
| InChIKey | YDLSIOHGPTUGGM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | 486 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate?
The IUPAC name of Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate (CID 3771443) is ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate.
What is the SMILES notation for Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate?
The canonical SMILES for Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate is CCOC(=O)C1=CN=C(N=C1NC2=CC=C(C=C2)OC)N3C(=CC(=N3)C)C.
What is the InChIKey of Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate?
The InChIKey is YDLSIOHGPTUGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c1-5-27-18(25)16-11-20-19(24-13(3)10-12(2)23-24)22-17(16)21-14-6-8-15(26-4)9-7-14/h6-11H,5H2,1-4H3,(H,20,21,22).
What are the key properties of Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate?
Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate has a molecular weight of 367.40 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 2-(3,5-dimethylpyrazol-1-yl)-4-(4-methoxyanilino)pyrimidine-5-carboxylate is sourced from PubChem (CID 3771443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).