About piperidine-4-carboxamide
piperidine-4-carboxamide (PubChem CID 3772) has the molecular formula C6H12N2O
and a molecular weight of 128.18 g/mol. Its IUPAC name is piperidine-4-carboxamide.
Molecular Properties
| Compound Name | piperidine-4-carboxamide |
| PubChem CID | 3772 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C6H12N2O/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9) |
| InChIKey | DPBWFNDFMCCGGJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-4-carboxamide?
The IUPAC name of piperidine-4-carboxamide (CID 3772) is piperidine-4-carboxamide.
What is the SMILES notation for piperidine-4-carboxamide?
The canonical SMILES for piperidine-4-carboxamide is NC(=O)C1CCNCC1.
What is the InChIKey of piperidine-4-carboxamide?
The InChIKey is DPBWFNDFMCCGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9).
What are the key properties of piperidine-4-carboxamide?
piperidine-4-carboxamide has a molecular weight of 128.18 g/mol, XLogP of -0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-4-carboxamide is sourced from PubChem (CID 3772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).