C29H28N2O4S — CID 3772717
2-[[4-[3-(2,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 3772717) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[[4-[3-(2,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | 2-[[4-[3-(2,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 3772717 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-[[4-[3-(2,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | CCOc1cc(C=c2sc3nc4ccccc4n3c2=O)ccc1OCCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C29H28N2O4S/c1-4-33-26-17-21(18-27-28(32)31-23-9-6-5-8-22(23)30-29(31)36-27)12-13-24(26)34-14-7-15-35-25-16-19(2)10-11-20(25)3/h5-6,8-13,16-18H,4,7,14-15H2,1-3H3 |
| InChIKey | XVXQYKLRALOACP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|