C16H23ClN2O4 — CID 3773328
methyl 2-[(5-chloro-2-methylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 3773328) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-methylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-[(5-chloro-2-methylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 3773328 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl 2-[(5-chloro-2-methylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)C(COC(C)(C)C)NC(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C16H23ClN2O4/c1-10-6-7-11(17)8-12(10)18-15(21)19-13(14(20)22-5)9-23-16(2,3)4/h6-8,13H,9H2,1-5H3,(H2,18,19,21) |
| InChIKey | DGZZJNPGEINGOJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |