C19H19NO2 — CID 3773404
2-(4-methoxy-3,5-dimethylphenyl)-6-methylindolizine-3-carbaldehyde (PubChem CID 3773404) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(4-methoxy-3,5-dimethylphenyl)-6-methylindolizine-3-carbaldehyde.
| Compound Name | 2-(4-methoxy-3,5-dimethylphenyl)-6-methylindolizine-3-carbaldehyde |
|---|---|
| PubChem CID | 3773404 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(4-methoxy-3,5-dimethylphenyl)-6-methylindolizine-3-carbaldehyde |
| SMILES | COc1c(C)cc(-c2cc3ccc(C)cn3c2C=O)cc1C |
| InChI | InChI=1S/C19H19NO2/c1-12-5-6-16-9-17(18(11-21)20(16)10-12)15-7-13(2)19(22-4)14(3)8-15/h5-11H,1-4H3 |
| InChIKey | BUCWWVUISYWSGR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|