About ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate
ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate (PubChem CID 3774152) has the molecular formula C11H12Cl3NO4S
and a molecular weight of 360.65 g/mol. Its IUPAC name is ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate |
| PubChem CID | 3774152 |
| Molecular Formula | C11H12Cl3NO4S |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate |
| SMILES | CCOC(=O)NC(C(Cl)(Cl)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12Cl3NO4S/c1-2-19-10(16)15-9(11(12,13)14)20(17,18)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,15,16) |
| InChIKey | GHESMMOAEVRGJN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate?
The IUPAC name of ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate (CID 3774152) is ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate.
What is the SMILES notation for ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate?
The canonical SMILES for ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate is CCOC(=O)NC(C(Cl)(Cl)Cl)S(=O)(=O)c1ccccc1.
What is the InChIKey of ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate?
The InChIKey is GHESMMOAEVRGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl3NO4S/c1-2-19-10(16)15-9(11(12,13)14)20(17,18)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,15,16).
What are the key properties of ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate?
ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate has a molecular weight of 360.65 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-(benzenesulfonyl)-2,2,2-trichloroethyl]carbamate is sourced from PubChem (CID 3774152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).