C16H20N6O3 — CID 3774350
2-N-(3,4-dimethylphenyl)-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine (PubChem CID 3774350) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,4-dimethylphenyl)-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3774350 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)-6-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N)c([N+](=O)[O-])c(N3CCOCC3)n2)cc1C |
| InChI | InChI=1S/C16H20N6O3/c1-10-3-4-12(9-11(10)2)18-16-19-14(17)13(22(23)24)15(20-16)21-5-7-25-8-6-21/h3-4,9H,5-8H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | PLWCCZYLPSGFJY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|