C22H20N4O3S — CID 3774378
5-methyl-3-phenyl-N-[[(2-phenylcyclopropanecarbonyl)amino]carbamothioyl]-1,2-oxazole-4-carboxamide (PubChem CID 3774378) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-methyl-3-phenyl-N-[[(2-phenylcyclopropanecarbonyl)amino]carbamothioyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-3-phenyl-N-[[(2-phenylcyclopropanecarbonyl)amino]carbamothioyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3774378 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-methyl-3-phenyl-N-[[(2-phenylcyclopropanecarbonyl)amino]carbamothioyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)NC(=S)NNC(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-13-18(19(26-29-13)15-10-6-3-7-11-15)21(28)23-22(30)25-24-20(27)17-12-16(17)14-8-4-2-5-9-14/h2-11,16-17H,12H2,1H3,(H,24,27)(H2,23,25,28,30) |
| InChIKey | PZKDBBORLLAPFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|