C25H27N3O7 — CID 3775880
3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 3775880) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3775880 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1cc(C=CC(=O)N2CCC(N3C(=O)OCC3c3ccccc3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H27N3O7/c1-33-22-14-18(20(28(31)32)15-23(22)34-2)8-9-24(29)26-12-10-19(11-13-26)27-21(16-35-25(27)30)17-6-4-3-5-7-17/h3-9,14-15,19,21H,10-13,16H2,1-2H3 |
| InChIKey | SPZZZVNGEJKAOA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|