About 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline
4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline (PubChem CID 3776314) has the molecular formula C15H20N6O2
and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline |
| PubChem CID | 3776314 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2nn(C)c(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N6O2/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-15-14(21(22)23)11(3)19(4)18-15/h7-10H,5-6H2,1-4H3/b17-16+ |
| InChIKey | CBTVICGCXKAORE-WUKNDPDISA-N |
| XLogP | 3.90 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline?
The IUPAC name of 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline (CID 3776314) is 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline.
What is the SMILES notation for 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline?
The canonical SMILES for 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline is CCN(CC)c1ccc(/N=N/c2nn(C)c(C)c2[N+](=O)[O-])cc1.
What is the InChIKey of 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline?
The InChIKey is CBTVICGCXKAORE-WUKNDPDISA-N. The full InChI is InChI=1S/C15H20N6O2/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-15-14(21(22)23)11(3)19(4)18-15/h7-10H,5-6H2,1-4H3/b17-16+.
What are the key properties of 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline?
4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline has a molecular weight of 316.37 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N,N-diethylaniline is sourced from PubChem (CID 3776314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).