C20H24N2O3 — CID 3776698
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(2-ethylphenyl)propanamide (PubChem CID 3776698) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 3776698 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C20H24N2O3/c1-2-12-5-3-4-6-15(12)21-16(23)9-10-22-19(24)17-13-7-8-14(11-13)18(17)20(22)25/h3-6,13-14,17-18H,2,7-11H2,1H3,(H,21,23) |
| InChIKey | XFGNOXOFRCMCQW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|