C21H24N4O8S — CID 3776854
N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide (PubChem CID 3776854) has the molecular formula C21H24N4O8S and a molecular weight of 492.51 g/mol. Its IUPAC name is N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide.
| Compound Name | N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3776854 |
| Molecular Formula | C21H24N4O8S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(O)CN1C(=O)NC(C)(C)C1=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O8S/c1-21(2)19(27)23(20(28)22-21)12-15(26)13-24(34(31,32)16-7-5-4-6-8-16)17-11-14(25(29)30)9-10-18(17)33-3/h4-11,15,26H,12-13H2,1-3H3,(H,22,28) |
| InChIKey | SGQFOUSLAFTZRW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 159.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|