About 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate
1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate (PubChem CID 3776887) has the molecular formula C10H16O6S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate |
| PubChem CID | 3776887 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16O6S/c1-3-16-10(12)8(9(11)15-2)7-4-5-17(13,14)6-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | URXAXCGKSSTNHR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate?
The IUPAC name of 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate (CID 3776887) is 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate?
The canonical SMILES for 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate is CCOC(=O)C(C(=O)OC)C1CCS(=O)(=O)C1.
What is the InChIKey of 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate?
The InChIKey is URXAXCGKSSTNHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6S/c1-3-16-10(12)8(9(11)15-2)7-4-5-17(13,14)6-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate?
1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate has a molecular weight of 264.30 g/mol, XLogP of -0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-methyl 2-(1,1-dioxothiolan-3-yl)propanedioate is sourced from PubChem (CID 3776887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).