About 1,3-diazatricyclo[8.4.0.03,8]tetradecane
1,3-diazatricyclo[8.4.0.03,8]tetradecane (PubChem CID 3777427) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1,3-diazatricyclo[8.4.0.03,8]tetradecane.
Molecular Properties
| Compound Name | 1,3-diazatricyclo[8.4.0.03,8]tetradecane |
| PubChem CID | 3777427 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1,3-diazatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C1CCN2CN3CCCCC3CC2C1 |
| InChI | InChI=1S/C12H22N2/c1-3-7-13-10-14-8-4-2-6-12(14)9-11(13)5-1/h11-12H,1-10H2 |
| InChIKey | OYQRYTGIMNBYQZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diazatricyclo[8.4.0.03,8]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diazatricyclo[8.4.0.03,8]tetradecane?
The IUPAC name of 1,3-diazatricyclo[8.4.0.03,8]tetradecane (CID 3777427) is 1,3-diazatricyclo[8.4.0.03,8]tetradecane.
What is the SMILES notation for 1,3-diazatricyclo[8.4.0.03,8]tetradecane?
The canonical SMILES for 1,3-diazatricyclo[8.4.0.03,8]tetradecane is C1CCN2CN3CCCCC3CC2C1.
What is the InChIKey of 1,3-diazatricyclo[8.4.0.03,8]tetradecane?
The InChIKey is OYQRYTGIMNBYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-3-7-13-10-14-8-4-2-6-12(14)9-11(13)5-1/h11-12H,1-10H2.
What are the key properties of 1,3-diazatricyclo[8.4.0.03,8]tetradecane?
1,3-diazatricyclo[8.4.0.03,8]tetradecane has a molecular weight of 194.32 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diazatricyclo[8.4.0.03,8]tetradecane is sourced from PubChem (CID 3777427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).