C19H21ClN6OS2 — CID 3777842
4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 3777842) has the molecular formula C19H21ClN6OS2 and a molecular weight of 449.01 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3777842 |
| Molecular Formula | C19H21ClN6OS2 |
| Molecular Weight | 449.01 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(c2ncnc3c(-c4ccc(Cl)cc4)nsc23)CC1 |
| InChI | InChI=1S/C19H21ClN6OS2/c1-27-11-6-21-19(28)26-9-7-25(8-10-26)18-17-16(22-12-23-18)15(24-29-17)13-2-4-14(20)5-3-13/h2-5,12H,6-11H2,1H3,(H,21,28) |
| InChIKey | ACSLYVCBIDSAIN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|