About 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide
2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide (PubChem CID 3777917) has the molecular formula C16H10Cl2N2OS
and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide.
Molecular Properties
| Compound Name | 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide |
| PubChem CID | 3777917 |
| Molecular Formula | C16H10Cl2N2OS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide |
| SMILES | N#CC(=Cc1ccccc1Oc1ccc(Cl)cc1Cl)C(N)=S |
| InChI | InChI=1S/C16H10Cl2N2OS/c17-12-5-6-15(13(18)8-12)21-14-4-2-1-3-10(14)7-11(9-19)16(20)22/h1-8H,(H2,20,22) |
| InChIKey | YNSQQDNUAOXDJQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide?
The IUPAC name of 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide (CID 3777917) is 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide.
What is the SMILES notation for 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide?
The canonical SMILES for 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide is N#CC(=Cc1ccccc1Oc1ccc(Cl)cc1Cl)C(N)=S.
What is the InChIKey of 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide?
The InChIKey is YNSQQDNUAOXDJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2OS/c17-12-5-6-15(13(18)8-12)21-14-4-2-1-3-10(14)7-11(9-19)16(20)22/h1-8H,(H2,20,22).
What are the key properties of 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide?
2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide has a molecular weight of 349.24 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-[2-(2,4-dichlorophenoxy)phenyl]prop-2-enethioamide is sourced from PubChem (CID 3777917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).