C18H16N6O2 — CID 3778073
5-nitro-N-prop-2-ynyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-amine (PubChem CID 3778073) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-nitro-N-prop-2-ynyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-amine.
| Compound Name | 5-nitro-N-prop-2-ynyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3778073 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-nitro-N-prop-2-ynyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-amine |
| SMILES | C#CCNc1ncnc(N2CCc3c([nH]c4ccccc34)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N6O2/c1-2-8-19-17-16(24(25)26)18(21-11-20-17)23-9-7-13-12-5-3-4-6-14(12)22-15(13)10-23/h1,3-6,11,22H,7-10H2,(H,19,20,21) |
| InChIKey | FXVOLRIUGONJKH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|