About methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate
methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate (PubChem CID 3778945) has the molecular formula C25H21N2S2+
and a molecular weight of 413.59 g/mol. Its IUPAC name is methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate.
Molecular Properties
| Compound Name | methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate |
| PubChem CID | 3778945 |
| Molecular Formula | C25H21N2S2+ |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate |
| SMILES | CSC(=S)N[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H20N2S2/c1-29-25(28)26-27-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(27)21-15-9-4-10-16-21/h2-18H,1H3/p+1 |
| InChIKey | GEDGQXUNUWCELG-UHFFFAOYSA-O |
| XLogP | 6.17 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate?
The IUPAC name of methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate (CID 3778945) is methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate.
What is the SMILES notation for methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate?
The canonical SMILES for methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate is CSC(=S)N[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate?
The InChIKey is GEDGQXUNUWCELG-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H20N2S2/c1-29-25(28)26-27-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(27)21-15-9-4-10-16-21/h2-18H,1H3/p+1.
What are the key properties of methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate?
methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate has a molecular weight of 413.59 g/mol, XLogP of 6.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,4,6-triphenylpyridin-1-ium-1-yl)carbamodithioate is sourced from PubChem (CID 3778945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).