C27H28N2O6S — CID 3779473
[3-(7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3779473) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is [3-(7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-(7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3779473 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [3-(7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cccc(C3NC(=O)c4c(sc5c4CCC(C)C5)N3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H28N2O6S/c1-14-8-9-18-21(10-14)36-26-22(18)25(30)28-24(29-26)15-6-5-7-17(11-15)35-27(31)16-12-19(32-2)23(34-4)20(13-16)33-3/h5-7,11-14,24,29H,8-10H2,1-4H3,(H,28,30) |
| InChIKey | HCYXTPZDZAGNNN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|