C22H33NO2 — CID 3779534
3-[(3,3-dimethylpiperidin-1-yl)methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 3779534) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 3-[(3,3-dimethylpiperidin-1-yl)methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 3-[(3,3-dimethylpiperidin-1-yl)methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 3779534 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 3-[(3,3-dimethylpiperidin-1-yl)methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCCC2(C)CC3OC(=O)C(CN4CCCC(C)(C)C4)C3C=C12 |
| InChI | InChI=1S/C22H33NO2/c1-15-7-5-9-22(4)12-19-16(11-18(15)22)17(20(24)25-19)13-23-10-6-8-21(2,3)14-23/h7,11,16-17,19H,5-6,8-10,12-14H2,1-4H3 |
| InChIKey | MWMPYXXDHZQTTO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |