About 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile
2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3779818) has the molecular formula C10H9ClN2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| PubChem CID | 3779818 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1Cl)CCCC2 |
| InChI | InChI=1S/C10H9ClN2/c11-10-8(6-12)5-7-3-1-2-4-9(7)13-10/h5H,1-4H2 |
| InChIKey | BWPSIGMJCQHAGB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The IUPAC name of 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile (CID 3779818) is 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
What is the SMILES notation for 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The canonical SMILES for 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile is N#Cc1cc2c(nc1Cl)CCCC2.
What is the InChIKey of 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The InChIKey is BWPSIGMJCQHAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2/c11-10-8(6-12)5-7-3-1-2-4-9(7)13-10/h5H,1-4H2.
What are the key properties of 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile has a molecular weight of 192.65 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonitrile is sourced from PubChem (CID 3779818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).