C18H20ClN3S — CID 3779856
5-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione (PubChem CID 3779856) has the molecular formula C18H20ClN3S and a molecular weight of 345.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 5-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 3779856 |
| Molecular Formula | C18H20ClN3S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=S)N(c2ccc(C)c(C)c2)N1 |
| InChI | InChI=1S/C18H20ClN3S/c1-4-18(14-6-8-15(19)9-7-14)20-17(23)22(21-18)16-10-5-12(2)13(3)11-16/h5-11,21H,4H2,1-3H3,(H,20,23) |
| InChIKey | IESZLNMUODLFMA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|