About phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone
phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone (PubChem CID 3780158) has the molecular formula C16H11NOS
and a molecular weight of 265.34 g/mol. Its IUPAC name is phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 3780158 |
| Molecular Formula | C16H11NOS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1ccccc1)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H11NOS/c18-15(12-7-3-1-4-8-12)14-11-17-16(19-14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | LWTNKOJBANXELS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone?
The IUPAC name of phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone (CID 3780158) is phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone is O=C(c1ccccc1)c1cnc(-c2ccccc2)s1.
What is the InChIKey of phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone?
The InChIKey is LWTNKOJBANXELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NOS/c18-15(12-7-3-1-4-8-12)14-11-17-16(19-14)13-9-5-2-6-10-13/h1-11H.
What are the key properties of phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone?
phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone has a molecular weight of 265.34 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2-phenyl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 3780158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).