C23H23ClN2O3S — CID 3780548
N-(4-chlorophenyl)-4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide (PubChem CID 3780548) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 3780548 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(Cl)cc3)cc2)c1C |
| InChI | InChI=1S/C23H23ClN2O3S/c1-14-13-15(2)17(4)22(16(14)3)30(28,29)26-21-9-5-18(6-10-21)23(27)25-20-11-7-19(24)8-12-20/h5-13,26H,1-4H3,(H,25,27) |
| InChIKey | WPEJGNYPWWNOJU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |