C26H26F5N3OS — CID 3780697
8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3780697) has the molecular formula C26H26F5N3OS and a molecular weight of 523.57 g/mol. Its IUPAC name is 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3780697 |
| Molecular Formula | C26H26F5N3OS |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | O=C(CC1Cc2ccccc2C1)N1CCC2(CC1)CCN(C(=S)Nc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C26H26F5N3OS/c27-19-20(28)22(30)24(23(31)21(19)29)32-25(36)34-10-7-26(14-34)5-8-33(9-6-26)18(35)13-15-11-16-3-1-2-4-17(16)12-15/h1-4,15H,5-14H2,(H,32,36) |
| InChIKey | XJPLPJASORFXQQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|