C26H30N2O5 — CID 3780898
5-(2,6-diethylphenyl)-3-(1-hydroxyethyl)-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3780898) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-3-(1-hydroxyethyl)-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-3-(1-hydroxyethyl)-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3780898 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 5-(2,6-diethylphenyl)-3-(1-hydroxyethyl)-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3ccccc3C)NC(C(=O)O)(C(C)O)C2C1=O |
| InChI | InChI=1S/C26H30N2O5/c1-5-16-11-9-12-17(6-2)22(16)28-23(30)19-20(24(28)31)26(15(4)29,25(32)33)27-21(19)18-13-8-7-10-14(18)3/h7-13,15,19-21,27,29H,5-6H2,1-4H3,(H,32,33) |
| InChIKey | UMQWUERLMJAMDZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|