About 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide
3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide (PubChem CID 3780901) has the molecular formula C23H18ClN3O4
and a molecular weight of 435.87 g/mol. Its IUPAC name is 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide.
Molecular Properties
| Compound Name | 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide |
| PubChem CID | 3780901 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide |
| SMILES | O=C(NNC1CC(=O)N(c2ccc(Oc3ccccc3)cc2)C1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClN3O4/c24-16-6-4-5-15(13-16)22(29)26-25-20-14-21(28)27(23(20)30)17-9-11-19(12-10-17)31-18-7-2-1-3-8-18/h1-13,20,25H,14H2,(H,26,29) |
| InChIKey | UDHJYJQVMUIEKN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide?
The IUPAC name of 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide (CID 3780901) is 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide.
What is the SMILES notation for 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide?
The canonical SMILES for 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide is O=C(NNC1CC(=O)N(c2ccc(Oc3ccccc3)cc2)C1=O)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide?
The InChIKey is UDHJYJQVMUIEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClN3O4/c24-16-6-4-5-15(13-16)22(29)26-25-20-14-21(28)27(23(20)30)17-9-11-19(12-10-17)31-18-7-2-1-3-8-18/h1-13,20,25H,14H2,(H,26,29).
What are the key properties of 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide?
3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide has a molecular weight of 435.87 g/mol, XLogP of 3.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N'-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]benzohydrazide is sourced from PubChem (CID 3780901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).