About 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile
2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile (PubChem CID 3781022) has the molecular formula C11H7N5
and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile |
| PubChem CID | 3781022 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1C(C#N)n1cncn1 |
| InChI | InChI=1S/C11H7N5/c12-5-9-3-1-2-4-10(9)11(6-13)16-8-14-7-15-16/h1-4,7-8,11H |
| InChIKey | CJRJBHQEZZCYQD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile?
The IUPAC name of 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile (CID 3781022) is 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile?
The canonical SMILES for 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile is N#Cc1ccccc1C(C#N)n1cncn1.
What is the InChIKey of 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile?
The InChIKey is CJRJBHQEZZCYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5/c12-5-9-3-1-2-4-10(9)11(6-13)16-8-14-7-15-16/h1-4,7-8,11H.
What are the key properties of 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile?
2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile has a molecular weight of 209.21 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyano(1,2,4-triazol-1-yl)methyl]benzonitrile is sourced from PubChem (CID 3781022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).