C23H29N3O4 — CID 3781402
2,6-bis(4-ethylphenyl)-4,4-dimethyl-3,5-dinitropiperidine (PubChem CID 3781402) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2,6-bis(4-ethylphenyl)-4,4-dimethyl-3,5-dinitropiperidine.
| Compound Name | 2,6-bis(4-ethylphenyl)-4,4-dimethyl-3,5-dinitropiperidine |
|---|---|
| PubChem CID | 3781402 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2,6-bis(4-ethylphenyl)-4,4-dimethyl-3,5-dinitropiperidine |
| SMILES | CCc1ccc(C2NC(c3ccc(CC)cc3)C([N+](=O)[O-])C(C)(C)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-5-15-7-11-17(12-8-15)19-21(25(27)28)23(3,4)22(26(29)30)20(24-19)18-13-9-16(6-2)10-14-18/h7-14,19-22,24H,5-6H2,1-4H3 |
| InChIKey | JTRXAGQKEBNGGS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|