C18H16F3IN2O3S — CID 3781441
N-(4-iodo-2-methylphenyl)-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 3781441) has the molecular formula C18H16F3IN2O3S and a molecular weight of 524.30 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 3781441 |
| Molecular Formula | C18H16F3IN2O3S |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | Cc1cc(I)ccc1NS(=O)(=O)c1ccc2c(c1)CN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C18H16F3IN2O3S/c1-11-8-14(22)3-5-16(11)23-28(26,27)15-4-2-12-6-7-24(10-13(12)9-15)17(25)18(19,20)21/h2-5,8-9,23H,6-7,10H2,1H3 |
| InChIKey | RVVPJQYSFWFDFR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|