About 2-amino-1-(3,5-dichlorophenyl)ethanol
2-amino-1-(3,5-dichlorophenyl)ethanol (PubChem CID 3782382) has the molecular formula C8H9Cl2NO
and a molecular weight of 206.07 g/mol. Its IUPAC name is 2-amino-1-(3,5-dichlorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(3,5-dichlorophenyl)ethanol |
| PubChem CID | 3782382 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2-amino-1-(3,5-dichlorophenyl)ethanol |
| SMILES | NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2NO/c9-6-1-5(8(12)4-11)2-7(10)3-6/h1-3,8,12H,4,11H2 |
| InChIKey | SWDAVNPCXAGELD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-(3,5-dichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3,5-dichlorophenyl)ethanol?
The IUPAC name of 2-amino-1-(3,5-dichlorophenyl)ethanol (CID 3782382) is 2-amino-1-(3,5-dichlorophenyl)ethanol.
What is the SMILES notation for 2-amino-1-(3,5-dichlorophenyl)ethanol?
The canonical SMILES for 2-amino-1-(3,5-dichlorophenyl)ethanol is NCC(O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-amino-1-(3,5-dichlorophenyl)ethanol?
The InChIKey is SWDAVNPCXAGELD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2NO/c9-6-1-5(8(12)4-11)2-7(10)3-6/h1-3,8,12H,4,11H2.
What are the key properties of 2-amino-1-(3,5-dichlorophenyl)ethanol?
2-amino-1-(3,5-dichlorophenyl)ethanol has a molecular weight of 206.07 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3,5-dichlorophenyl)ethanol is sourced from PubChem (CID 3782382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).