About benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate
benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate (PubChem CID 3782471) has the molecular formula C23H25F3N2O3S
and a molecular weight of 466.53 g/mol. Its IUPAC name is benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate |
| PubChem CID | 3782471 |
| Molecular Formula | C23H25F3N2O3S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate |
| SMILES | O=C(CN1CCCN(C(=O)Cc2cccc(SC(F)(F)F)c2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H25F3N2O3S/c24-23(25,26)32-20-9-4-8-19(14-20)15-21(29)28-11-5-10-27(12-13-28)16-22(30)31-17-18-6-2-1-3-7-18/h1-4,6-9,14H,5,10-13,15-17H2 |
| InChIKey | GNWFYEVCPGJBRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate?
The IUPAC name of benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate (CID 3782471) is benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate.
What is the SMILES notation for benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate?
The canonical SMILES for benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate is O=C(CN1CCCN(C(=O)Cc2cccc(SC(F)(F)F)c2)CC1)OCc1ccccc1.
What is the InChIKey of benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate?
The InChIKey is GNWFYEVCPGJBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F3N2O3S/c24-23(25,26)32-20-9-4-8-19(14-20)15-21(29)28-11-5-10-27(12-13-28)16-22(30)31-17-18-6-2-1-3-7-18/h1-4,6-9,14H,5,10-13,15-17H2.
What are the key properties of benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate?
benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate has a molecular weight of 466.53 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[4-[2-[3-(trifluoromethylsulfanyl)phenyl]acetyl]-1,4-diazepan-1-yl]acetate is sourced from PubChem (CID 3782471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).