C16H28N+ — CID 3782715
2-ethyl-4,10b-dimethyl-2,3,5,6,7,8,9,10-octahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium (PubChem CID 3782715) has the molecular formula C16H28N+ and a molecular weight of 234.41 g/mol. Its IUPAC name is 2-ethyl-4,10b-dimethyl-2,3,5,6,7,8,9,10-octahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium.
| Compound Name | 2-ethyl-4,10b-dimethyl-2,3,5,6,7,8,9,10-octahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 3782715 |
| Molecular Formula | C16H28N+ |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | 2-ethyl-4,10b-dimethyl-2,3,5,6,7,8,9,10-octahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1CC2(C)C3=C(CCCC3)CC[N+]2(C)C1 |
| InChI | InChI=1S/C16H28N/c1-4-13-11-16(2)15-8-6-5-7-14(15)9-10-17(16,3)12-13/h13H,4-12H2,1-3H3/q+1 |
| InChIKey | VIWFGNRJHKAKFA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|