About N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine
N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine (PubChem CID 3783256) has the molecular formula C21H15ClN2S
and a molecular weight of 362.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine |
| PubChem CID | 3783256 |
| Molecular Formula | C21H15ClN2S |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine |
| SMILES | Clc1ccc(Nc2sc(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15ClN2S/c22-17-11-13-18(14-12-17)23-21-19(15-7-3-1-4-8-15)24-20(25-21)16-9-5-2-6-10-16/h1-14,23H |
| InChIKey | MTLNJFQBRIEAOQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine?
The IUPAC name of N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine (CID 3783256) is N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine.
What is the SMILES notation for N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine?
The canonical SMILES for N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine is Clc1ccc(Nc2sc(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine?
The InChIKey is MTLNJFQBRIEAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN2S/c22-17-11-13-18(14-12-17)23-21-19(15-7-3-1-4-8-15)24-20(25-21)16-9-5-2-6-10-16/h1-14,23H.
What are the key properties of N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine?
N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine has a molecular weight of 362.89 g/mol, XLogP of 6.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-2,4-diphenyl-1,3-thiazol-5-amine is sourced from PubChem (CID 3783256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).