C17H21N5O5S — CID 3783425
4-amino-5-N-[2-(2-methoxyethylamino)-2-oxoethyl]-5-N-(4-methoxyphenyl)-1,2-thiazole-3,5-dicarboxamide (PubChem CID 3783425) has the molecular formula C17H21N5O5S and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxoethyl]-5-N-(4-methoxyphenyl)-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxoethyl]-5-N-(4-methoxyphenyl)-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 3783425 |
| Molecular Formula | C17H21N5O5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxoethyl]-5-N-(4-methoxyphenyl)-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COCCNC(=O)CN(C(=O)c1snc(C(N)=O)c1N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H21N5O5S/c1-26-8-7-20-12(23)9-22(10-3-5-11(27-2)6-4-10)17(25)15-13(18)14(16(19)24)21-28-15/h3-6H,7-9,18H2,1-2H3,(H2,19,24)(H,20,23) |
| InChIKey | UJYSNNXGBHOMBV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|