About 4-methoxybenzoate
4-methoxybenzoate (PubChem CID 3783514) has the molecular formula C8H7O3-
and a molecular weight of 151.14 g/mol. Its IUPAC name is 4-methoxybenzoate.
Molecular Properties
| Compound Name | 4-methoxybenzoate |
| PubChem CID | 3783514 |
| Molecular Formula | C8H7O3- |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | ZEYHEAKUIGZSGI-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzoate?
The IUPAC name of 4-methoxybenzoate (CID 3783514) is 4-methoxybenzoate.
What is the SMILES notation for 4-methoxybenzoate?
The canonical SMILES for 4-methoxybenzoate is COc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-methoxybenzoate?
The InChIKey is ZEYHEAKUIGZSGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/p-1.
What are the key properties of 4-methoxybenzoate?
4-methoxybenzoate has a molecular weight of 151.14 g/mol, XLogP of 0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzoate is sourced from PubChem (CID 3783514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).