About 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea
1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea (PubChem CID 3783826) has the molecular formula C16H15Cl2N3OS
and a molecular weight of 368.29 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea.
Molecular Properties
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea |
| PubChem CID | 3783826 |
| Molecular Formula | C16H15Cl2N3OS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cccn(Cc2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-2-7-19-16(23)20-14-4-3-8-21(15(14)22)10-11-5-6-12(17)13(18)9-11/h2-6,8-9H,1,7,10H2,(H2,19,20,23) |
| InChIKey | VOQWUIWZVUJFST-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea?
The IUPAC name of 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea (CID 3783826) is 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea.
What is the SMILES notation for 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea?
The canonical SMILES for 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea is C=CCNC(=S)Nc1cccn(Cc2ccc(Cl)c(Cl)c2)c1=O.
What is the InChIKey of 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea?
The InChIKey is VOQWUIWZVUJFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2N3OS/c1-2-7-19-16(23)20-14-4-3-8-21(15(14)22)10-11-5-6-12(17)13(18)9-11/h2-6,8-9H,1,7,10H2,(H2,19,20,23).
What are the key properties of 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea?
1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea has a molecular weight of 368.29 g/mol, XLogP of 3.68, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,4-dichlorophenyl)methyl]-2-oxo-3-pyridinyl]-3-prop-2-enylthiourea is sourced from PubChem (CID 3783826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).