C12H13ClF3NO — CID 3783853
3-chloro-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 3783853) has the molecular formula C12H13ClF3NO and a molecular weight of 279.69 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3783853 |
| Molecular Formula | C12H13ClF3NO |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13ClF3NO/c1-11(2,7-13)10(18)17-9-5-3-8(4-6-9)12(14,15)16/h3-6H,7H2,1-2H3,(H,17,18) |
| InChIKey | QCQZFHOGRCQNIH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|